Products 189308-09-6
CAS 189308-09-6 appears in our catalog under these names: Danshenol B, Danshenol B. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, Get quote.
(1R,10S)-10-hydroxy-1,6,6-trimethyl-10-(2-oxopropyl)-2,7,8,9-tetrahydro-1H-naphtho[1,2-g][1]benzofuran-11-one (CAS 189308-09-6) is a chemical compound with the molecular formula C22H26O4 and a molecular weight of 354.4 g/mol. IUPAC name: (1R,10S)-10-hydroxy-1,6,6-trimethyl-10-(2-oxopropyl)-2,7,8,9-tetrahydro-1H-naphtho[1,2-g][1]benzofuran-11-one. InChIKey: KZLPKGGMSDHTRS-YTEVENLXSA-N.
| Molecular formula | C22H26O4 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (1R,10S)-10-hydroxy-1,6,6-trimethyl-10-(2-oxopropyl)-2,7,8,9-tetrahydro-1H-naphtho[1,2-g][1]benzofuran-11-one |
| InChIKey | KZLPKGGMSDHTRS-YTEVENLXSA-N |
| SMILES | C[C@H]1COC2=C1C(=O)[C@@](C3=C2C=CC4=C3CCCC4(C)C)(CC(=O)C)O |
Computed by PubChem (NCBI)
Synonyms:
Danshenol B, orb2279386