Products 1893597-57-3
CAS 1893597-57-3 appears in our catalog under these names: rel-(3R,4S)-4-(4-Nitrophenyl)-3-pyrrolidinecarboxylic acid, 95%, 95%, (3R,4S)-4-(4-Nitrophenyl)pyrrolidine-3-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(3R,4S)-4-(4-nitrophenyl)pyrrolidine-3-carboxylic acid (CAS 1893597-57-3) is a chemical compound with the molecular formula C11H12N2O4 and a molecular weight of 236.22 g/mol. IUPAC name: (3R,4S)-4-(4-nitrophenyl)pyrrolidine-3-carboxylic acid. InChIKey: UHORFZASTCWSKS-ZJUUUORDSA-N.
| Molecular formula | C11H12N2O4 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | (3R,4S)-4-(4-nitrophenyl)pyrrolidine-3-carboxylic acid |
| InChIKey | UHORFZASTCWSKS-ZJUUUORDSA-N |
| SMILES | C1[C@@H]([C@H](CN1)C(=O)O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)