CAS 1893599-38-6 is the registry number for 3-Bromo-4'-chloro-4-fluoro-1,1'-biphenyl. Offered by: TRC. Available pack sizes: 1g.
2-bromo-4-(4-chlorophenyl)-1-fluorobenzene (CAS 1893599-38-6) is a chemical compound with the molecular formula C12H7BrClF and a molecular weight of 285.54 g/mol. IUPAC name: 2-bromo-4-(4-chlorophenyl)-1-fluorobenzene. InChIKey: KPFYOZSEFPRRIM-UHFFFAOYSA-N.
| Molecular formula | C12H7BrClF |
|---|---|
| Molecular weight | 285.54 g/mol |
| IUPAC name | 2-bromo-4-(4-chlorophenyl)-1-fluorobenzene |
| InChIKey | KPFYOZSEFPRRIM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)F)Br)Cl |
Computed by PubChem (NCBI)