CAS 2755717-23-6 is the registry number for 4-Bromo-3-chloro-2-fluoro-1,1'-biphenyl, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-bromo-2-chloro-3-fluoro-4-phenylbenzene (CAS 2755717-23-6) is a chemical compound with the molecular formula C12H7BrClF and a molecular weight of 285.54 g/mol. IUPAC name: 1-bromo-2-chloro-3-fluoro-4-phenylbenzene. InChIKey: CJTWLHCNKBOCCP-UHFFFAOYSA-N.
| Molecular formula | C12H7BrClF |
|---|---|
| Molecular weight | 285.54 g/mol |
| IUPAC name | 1-bromo-2-chloro-3-fluoro-4-phenylbenzene |
| InChIKey | CJTWLHCNKBOCCP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=C(C=C2)Br)Cl)F |
Computed by PubChem (NCBI)