CAS 2379321-84-1 is the registry number for 2-Bromo-4'-chloro-4-fluoro-1,1'-biphenyl, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-bromo-1-(4-chlorophenyl)-4-fluorobenzene (CAS 2379321-84-1) is a chemical compound with the molecular formula C12H7BrClF and a molecular weight of 285.54 g/mol. IUPAC name: 2-bromo-1-(4-chlorophenyl)-4-fluorobenzene. InChIKey: KKKJBKYUQWCXSR-UHFFFAOYSA-N.
| Molecular formula | C12H7BrClF |
|---|---|
| Molecular weight | 285.54 g/mol |
| IUPAC name | 2-bromo-1-(4-chlorophenyl)-4-fluorobenzene |
| InChIKey | KKKJBKYUQWCXSR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)F)Br)Cl |
Computed by PubChem (NCBI)