CAS 1893906-37-0 is the registry number for 4-(3H-[1,2,3]Triazolo[4,5-b]pyridin-3-yl)tetrahydro-2H-thiopyran 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(triazolo[4,5-b]pyridin-3-yl)thiane 1,1-dioxide (CAS 1893906-37-0) is a chemical compound with the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. IUPAC name: 4-(triazolo[4,5-b]pyridin-3-yl)thiane 1,1-dioxide. InChIKey: OTTSGCZHBTVDKO-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O2S |
|---|---|
| Molecular weight | 252.30 g/mol |
| IUPAC name | 4-(triazolo[4,5-b]pyridin-3-yl)thiane 1,1-dioxide |
| InChIKey | OTTSGCZHBTVDKO-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1N2C3=C(C=CC=N3)N=N2 |
Computed by PubChem (NCBI)