Products 1895027-51-6

CAS 1895027-51-6 appears in our catalog under these names: 2,6-Dimethoxypyridine-3-sulfonyl chloride, 95%, 2,6-Dimethoxypyridine-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2,6-dimethoxypyridine-3-sulfonyl chloride (CAS 1895027-51-6) is a chemical compound with the molecular formula C7H8ClNO4S and a molecular weight of 237.66 g/mol. IUPAC name: 2,6-dimethoxypyridine-3-sulfonyl chloride. InChIKey: ZVYQNOAGZOEXPH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8ClNO4S
Molecular weight237.66 g/mol
IUPAC name2,6-dimethoxypyridine-3-sulfonyl chloride
InChIKeyZVYQNOAGZOEXPH-UHFFFAOYSA-N
SMILESCOC1=NC(=C(C=C1)S(=O)(=O)Cl)OC

Computed by PubChem (NCBI)