CAS 2377035-98-6 is the registry number for 1,1-Dioxo-2H,3H,5H-1λ6-thieno(2,3-c)pyrrole-2-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1,1-dioxo-3,5-dihydro-2H-thieno[2,3-c]pyrrole-2-carboxylic acid;hydrochloride (CAS 2377035-98-6) is a chemical compound with the molecular formula C7H8ClNO4S and a molecular weight of 237.66 g/mol. IUPAC name: 1,1-dioxo-3,5-dihydro-2H-thieno[2,3-c]pyrrole-2-carboxylic acid;hydrochloride. InChIKey: GFHGPWYWQLAPOV-UHFFFAOYSA-N.
| Molecular formula | C7H8ClNO4S |
|---|---|
| Molecular weight | 237.66 g/mol |
| IUPAC name | 1,1-dioxo-3,5-dihydro-2H-thieno[2,3-c]pyrrole-2-carboxylic acid;hydrochloride |
| InChIKey | GFHGPWYWQLAPOV-UHFFFAOYSA-N |
| SMILES | C1C(S(=O)(=O)C2=CNC=C21)C(=O)O.Cl |
Computed by PubChem (NCBI)