CAS 2092694-14-7 is the registry number for {4H,6H,7H-pyrano(3,4-d)(1,2)oxazol-3-yl}methanesulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
6,7-dihydro-4H-pyrano[3,4-d][1,2]oxazol-3-ylmethanesulfonyl chloride (CAS 2092694-14-7) is a chemical compound with the molecular formula C7H8ClNO4S and a molecular weight of 237.66 g/mol. IUPAC name: 6,7-dihydro-4H-pyrano[3,4-d][1,2]oxazol-3-ylmethanesulfonyl chloride. InChIKey: HJIWDPRJFWAAJE-UHFFFAOYSA-N.
| Molecular formula | C7H8ClNO4S |
|---|---|
| Molecular weight | 237.66 g/mol |
| IUPAC name | 6,7-dihydro-4H-pyrano[3,4-d][1,2]oxazol-3-ylmethanesulfonyl chloride |
| InChIKey | HJIWDPRJFWAAJE-UHFFFAOYSA-N |
| SMILES | C1COCC2=C1ON=C2CS(=O)(=O)Cl |
Computed by PubChem (NCBI)