CAS 1895095-29-0 is the registry number for 2-(2,6-Difluoro-3-(methylthio)phenyl)propan-2-ol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(2,6-difluoro-3-methylsulfanylphenyl)propan-2-ol (CAS 1895095-29-0) is a chemical compound with the molecular formula C10H12F2OS and a molecular weight of 218.27 g/mol. IUPAC name: 2-(2,6-difluoro-3-methylsulfanylphenyl)propan-2-ol. InChIKey: NPRPSSWJQQYYGS-UHFFFAOYSA-N.
| Molecular formula | C10H12F2OS |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | 2-(2,6-difluoro-3-methylsulfanylphenyl)propan-2-ol |
| InChIKey | NPRPSSWJQQYYGS-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C=CC(=C1F)SC)F)O |
Computed by PubChem (NCBI)