CAS 2901065-31-2 is the registry number for (2,6-Difluoro-4-isopropoxyphenyl)(methyl)sulfane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,3-difluoro-2-methylsulfanyl-5-propan-2-yloxybenzene (CAS 2901065-31-2) is a chemical compound with the molecular formula C10H12F2OS and a molecular weight of 218.27 g/mol. IUPAC name: 1,3-difluoro-2-methylsulfanyl-5-propan-2-yloxybenzene. InChIKey: KFSNECIEORDPQB-UHFFFAOYSA-N.
| Molecular formula | C10H12F2OS |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | 1,3-difluoro-2-methylsulfanyl-5-propan-2-yloxybenzene |
| InChIKey | KFSNECIEORDPQB-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=C(C(=C1)F)SC)F |
Computed by PubChem (NCBI)