CAS 2624417-69-0 appears in our catalog under these names: (2,3-Difluoro-4-isopropoxyphenyl)(methyl)sulfane, ≥95%, ≥95%, (2,3-Difluoro-4-isopropoxyphenyl)(methyl)sulfane, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
2,3-difluoro-1-methylsulfanyl-4-propan-2-yloxybenzene (CAS 2624417-69-0) is a chemical compound with the molecular formula C10H12F2OS and a molecular weight of 218.27 g/mol. IUPAC name: 2,3-difluoro-1-methylsulfanyl-4-propan-2-yloxybenzene. InChIKey: MCAXVDIPLZJDQY-UHFFFAOYSA-N.
| Molecular formula | C10H12F2OS |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | 2,3-difluoro-1-methylsulfanyl-4-propan-2-yloxybenzene |
| InChIKey | MCAXVDIPLZJDQY-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C(=C(C=C1)SC)F)F |
Computed by PubChem (NCBI)