CAS 189564-60-1 is the registry number for 2-Ethoxy-1,3-dimethoxy-5-nitrobenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-ethoxy-1,3-dimethoxy-5-nitrobenzene (CAS 189564-60-1) is a chemical compound with the molecular formula C10H13NO5 and a molecular weight of 227.21 g/mol. IUPAC name: 2-ethoxy-1,3-dimethoxy-5-nitrobenzene. InChIKey: OHDURDXCCGUNOA-UHFFFAOYSA-N.
| Molecular formula | C10H13NO5 |
|---|---|
| Molecular weight | 227.21 g/mol |
| IUPAC name | 2-ethoxy-1,3-dimethoxy-5-nitrobenzene |
| InChIKey | OHDURDXCCGUNOA-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1OC)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)