Products 1895857-61-0

CAS 1895857-61-0 is the registry number for [4-(2-Fluoro-benzyloxy)-pyrazol-1-yl]-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[4-[(2-fluorophenyl)methoxy]pyrazol-1-yl]acetic acid (CAS 1895857-61-0) is a chemical compound with the molecular formula C12H11FN2O3 and a molecular weight of 250.23 g/mol. IUPAC name: 2-[4-[(2-fluorophenyl)methoxy]pyrazol-1-yl]acetic acid. InChIKey: RMYHGXQYMOFHBG-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11FN2O3
Molecular weight250.23 g/mol
IUPAC name2-[4-[(2-fluorophenyl)methoxy]pyrazol-1-yl]acetic acid
InChIKeyRMYHGXQYMOFHBG-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)COC2=CN(N=C2)CC(=O)O)F

Computed by PubChem (NCBI)