Products 937620-39-8
CAS 937620-39-8 appears in our catalog under these names: 3-[3-(4-Fluoro-3-methylphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid, 95%, 3-(3-(4-Fluoro-3-methylphenyl)-1,2,4-oxadiazol-5-yl)propanoic acid, 95%, 3-(3-(4-Fluoro-3-methylphenyl)-1,2,4-oxadiazol-5-yl)propanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
3-[3-(4-fluoro-3-methylphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid (CAS 937620-39-8) is a chemical compound with the molecular formula C12H11FN2O3 and a molecular weight of 250.23 g/mol. IUPAC name: 3-[3-(4-fluoro-3-methylphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid. InChIKey: GHAQDGXDFQLUJU-UHFFFAOYSA-N.
| Molecular formula | C12H11FN2O3 |
|---|---|
| Molecular weight | 250.23 g/mol |
| IUPAC name | 3-[3-(4-fluoro-3-methylphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid |
| InChIKey | GHAQDGXDFQLUJU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=NOC(=N2)CCC(=O)O)F |
Computed by PubChem (NCBI)