CAS 944787-35-3 is the registry number for Methyl [1-(4-fluorophenyl)-5-hydroxy-1h-pyrazol-3-yl]acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 2-[2-(4-fluorophenyl)-3-oxo-1H-pyrazol-5-yl]acetate (CAS 944787-35-3) is a chemical compound with the molecular formula C12H11FN2O3 and a molecular weight of 250.23 g/mol. IUPAC name: methyl 2-[2-(4-fluorophenyl)-3-oxo-1H-pyrazol-5-yl]acetate. InChIKey: FMABWDMGQGVHHX-UHFFFAOYSA-N.
| Molecular formula | C12H11FN2O3 |
|---|---|
| Molecular weight | 250.23 g/mol |
| IUPAC name | methyl 2-[2-(4-fluorophenyl)-3-oxo-1H-pyrazol-5-yl]acetate |
| InChIKey | FMABWDMGQGVHHX-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=O)N(N1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)