CAS 1895912-86-3 appears in our catalog under these names: (3R,4R)-3-Fluorooxan-4-amine hydrochloride, 95%, (3R,4R)-3-Fluorotetrahydro-2H-pyran-4-amine hydrochloride 98%, (3R,4R)-3-Fluorotetrahydro-2H-pyran-4-amine hydrochloride, 98%, 98%, (3R,4R)-3-Fluorotetrahydro-2H-pyran-4-amine hydrochloride, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 25mg, 50mg, 5g, 500mg.
(3R,4R)-3-fluorooxan-4-amine;hydrochloride (CAS 1895912-86-3) is a chemical compound with the molecular formula C5H11ClFNO and a molecular weight of 155.60 g/mol. IUPAC name: (3R,4R)-3-fluorooxan-4-amine;hydrochloride. InChIKey: JYZWPWDEIMDHFF-UYXJWNHNSA-N.
| Molecular formula | C5H11ClFNO |
|---|---|
| Molecular weight | 155.60 g/mol |
| IUPAC name | (3R,4R)-3-fluorooxan-4-amine;hydrochloride |
| InChIKey | JYZWPWDEIMDHFF-UYXJWNHNSA-N |
| SMILES | C1COC[C@@H]([C@@H]1N)F.Cl |
Computed by PubChem (NCBI)