Products 1896166-65-6

CAS 1896166-65-6 is the registry number for 2-Ethoxypyridine-4-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-ethoxypyridine-4-sulfonyl chloride (CAS 1896166-65-6) is a chemical compound with the molecular formula C7H8ClNO3S and a molecular weight of 221.66 g/mol. IUPAC name: 2-ethoxypyridine-4-sulfonyl chloride. InChIKey: MVWNIXBSMVMPFQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8ClNO3S
Molecular weight221.66 g/mol
IUPAC name2-ethoxypyridine-4-sulfonyl chloride
InChIKeyMVWNIXBSMVMPFQ-UHFFFAOYSA-N
SMILESCCOC1=NC=CC(=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)