Products 6387-27-5
CAS 6387-27-5 appears in our catalog under these names: 3-amino-5-chloro-4-methylbenzenesulfonic acid, 3-Amino-5-chloro-4-methylbenzenesulfonic acid, 95%, 95%, 3-Amino-5-chloro-4-methylbenzenesulfonic acid, 95%. Offered by: TRC, Chemat, Fluorochem. Available pack sizes: 500mg, 100mg, 250mg, 1g, 5g.
3-amino-5-chloro-4-methylbenzenesulfonic acid (CAS 6387-27-5) is a chemical compound with the molecular formula C7H8ClNO3S and a molecular weight of 221.66 g/mol. IUPAC name: 3-amino-5-chloro-4-methylbenzenesulfonic acid. InChIKey: RSCRGMCYBCTJGF-UHFFFAOYSA-N.
| Molecular formula | C7H8ClNO3S |
|---|---|
| Molecular weight | 221.66 g/mol |
| IUPAC name | 3-amino-5-chloro-4-methylbenzenesulfonic acid |
| InChIKey | RSCRGMCYBCTJGF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Cl)S(=O)(=O)O)N |
Computed by PubChem (NCBI)