CAS 6387-14-0 appears in our catalog under these names: Lamotrigine Impurity 14, 4-amino-3-chloro-5-methylbenzenesulfonic acid. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-3-chloro-5-methylbenzenesulfonic acid (CAS 6387-14-0) is a chemical compound with the molecular formula C7H8ClNO3S and a molecular weight of 221.66 g/mol. IUPAC name: 4-amino-3-chloro-5-methylbenzenesulfonic acid. InChIKey: DTQVHBIQMCFTSZ-UHFFFAOYSA-N.
| Molecular formula | C7H8ClNO3S |
|---|---|
| Molecular weight | 221.66 g/mol |
| IUPAC name | 4-amino-3-chloro-5-methylbenzenesulfonic acid |
| InChIKey | DTQVHBIQMCFTSZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)Cl)S(=O)(=O)O |
Computed by PubChem (NCBI)