Products 1896597-64-0
CAS 1896597-64-0 is the registry number for 1-Acetyl-N,N-dimethylcyclopropane-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-acetyl-N,N-dimethylcyclopropane-1-sulfonamide (CAS 1896597-64-0) is a chemical compound with the molecular formula C7H13NO3S and a molecular weight of 191.25 g/mol. IUPAC name: 1-acetyl-N,N-dimethylcyclopropane-1-sulfonamide. InChIKey: LBAHENMWUSKURI-UHFFFAOYSA-N.
| Molecular formula | C7H13NO3S |
|---|---|
| Molecular weight | 191.25 g/mol |
| IUPAC name | 1-acetyl-N,N-dimethylcyclopropane-1-sulfonamide |
| InChIKey | LBAHENMWUSKURI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1(CC1)S(=O)(=O)N(C)C |
Computed by PubChem (NCBI)