CAS 1896825-95-8 is the registry number for {(1,2,4)Triazolo(1,5-a)pyrimidin-2-yl}methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
[1,2,4]triazolo[1,5-a]pyrimidin-2-ylmethanamine;hydrochloride (CAS 1896825-95-8) is a chemical compound with the molecular formula C6H8ClN5 and a molecular weight of 185.61 g/mol. IUPAC name: [1,2,4]triazolo[1,5-a]pyrimidin-2-ylmethanamine;hydrochloride. InChIKey: MYEXIEIXMCAFQI-UHFFFAOYSA-N.
| Molecular formula | C6H8ClN5 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | [1,2,4]triazolo[1,5-a]pyrimidin-2-ylmethanamine;hydrochloride |
| InChIKey | MYEXIEIXMCAFQI-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=N2)CN)N=C1.Cl |
Computed by PubChem (NCBI)