CAS 2219380-27-3 is the registry number for 7H-Pyrrolo(2,3-d)pyrimidine-2,4-diamine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine;hydrochloride (CAS 2219380-27-3) is a chemical compound with the molecular formula C6H8ClN5 and a molecular weight of 185.61 g/mol. IUPAC name: 7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine;hydrochloride. InChIKey: CSZUNPBTVMTZCN-UHFFFAOYSA-N.
| Molecular formula | C6H8ClN5 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine;hydrochloride |
| InChIKey | CSZUNPBTVMTZCN-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC(=NC(=C21)N)N.Cl |
Computed by PubChem (NCBI)