Products 1899-93-0
CAS 1899-93-0 appears in our catalog under these names: m-Toluenesulfonyl Chloride, m–Toluenesulfonyl chloride, m-Toluenesulfonyl chloride, 98% , m-Toluenesulfonyl chloride 98%, M-TOLUENESULFONYL CHLORIDE, 97%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 100g, 25g, 5g.
3-methylbenzenesulfonyl chloride (CAS 1899-93-0) is a chemical compound with the molecular formula C7H7ClO2S and a molecular weight of 190.65 g/mol. IUPAC name: 3-methylbenzenesulfonyl chloride. InChIKey: KFPMLWUKHQMEBU-UHFFFAOYSA-N.
| Molecular formula | C7H7ClO2S |
|---|---|
| Molecular weight | 190.65 g/mol |
| IUPAC name | 3-methylbenzenesulfonyl chloride |
| InChIKey | KFPMLWUKHQMEBU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
3-methylbenzenesulphonyl chloride, 3-methylbenzenesulfonyl Chloride, m-Toluenesulfonyl chloride, 3-Toluenesulfonyl chloride, 3-methylbenzene-1-sulfonyl chloride, Benzenesulfonyl chloride, 3-methyl-, 3-methyl-benzenesulfonyl chloride, 3-methylphenylsulfonyl chloride, 3-toluenesulphonyl chloride, m-methylphenylsulfonylchloride