CAS 498-59-9 appears in our catalog under these names: S,S'-Methylenebis[L-cysteine], 98%, 98%, Djenkolic acid, 98%, Djenkolic acid 98%, P-Toluenesulfonyl chloride, 98%, p-Toluenesulfonyl chloride, 98% . Offered by: Chemat, Combi-blocks, Ambeed, Fluorochem, Thermo Scientific (Alfa Aesar). Available pack sizes: 100mg, 250mg, 1g, 10g, 5g, 100g, 1kg, 25g.
4-methylbenzenesulfonyl chloride (CAS 98-59-9) is a chemical compound with the molecular formula C7H7ClO2S and a molecular weight of 190.65 g/mol. IUPAC name: 4-methylbenzenesulfonyl chloride. InChIKey: YYROPELSRYBVMQ-UHFFFAOYSA-N.
| Molecular formula | C7H7ClO2S |
|---|---|
| Molecular weight | 190.65 g/mol |
| IUPAC name | 4-methylbenzenesulfonyl chloride |
| InChIKey | YYROPELSRYBVMQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)