Products 1939-99-7
CAS 1939-99-7 appears in our catalog under these names: ^a-Toluenesulfonyl chloride, 99% , Alpha-toluenesulfonyl chloride, 98%, Alpha-Toluenesulfonyl Chloride, α–Toluenesulfonyl Chloride, Benzylsulfonyl Chloride, >97.0%(T). Offered by: Thermo Scientific (Alfa Aesar), Combi-blocks, TRC, GLPBio, Thermo Scientific (Acros). Available pack sizes: 5g, 25g, 100g, 1g, 250mg, 500g, 10g.
Phenylmethanesulfonyl chloride (CAS 1939-99-7) is a chemical compound with the molecular formula C7H7ClO2S and a molecular weight of 190.65 g/mol. IUPAC name: phenylmethanesulfonyl chloride. InChIKey: OAHKWDDSKCRNFE-UHFFFAOYSA-N.
| Molecular formula | C7H7ClO2S |
|---|---|
| Molecular weight | 190.65 g/mol |
| IUPAC name | phenylmethanesulfonyl chloride |
| InChIKey | OAHKWDDSKCRNFE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
Phenylmethanesulfonyl chloride, alpha-Toluenesulfonyl chloride, Benzylsulfonyl chloride, Benzenemethanesulfonyl chloride, Benzylsulfochloride, a-toluenesulfonyl chloride, .alpha.-Toluenesulfonyl chloride, Methanesulfonyl chloride, phenyl-, Phenylmethylsulfonyl chloride, Phenyl-Methanesulfonyl Chloride