Products 18991-62-3
CAS 18991-62-3 appears in our catalog under these names: D-Glucose-6,6-d2, >95% (HPLC), D-Glucose-6,6-d2, 98 atom % D, min 98% Chemical Purity, D–Glucose–6，6–d2, D-(6,6'-2H2)Glucose, D-GLUCOSE-6,6-D2, >=98 ATOM % D, >=99% &. Offered by: TRC, CDN, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 100mg, 10mg, 1g, 250mg, 2g, 5g, 500MG, 100 mg.
(3R,4S,5S,6R)-6-[dideuterio(hydroxy)methyl]oxane-2,3,4,5-tetrol (CAS 18991-62-3) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 182.17 g/mol. IUPAC name: (3R,4S,5S,6R)-6-[dideuterio(hydroxy)methyl]oxane-2,3,4,5-tetrol. InChIKey: WQZGKKKJIJFFOK-VARZTKRMSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | (3R,4S,5S,6R)-6-[dideuterio(hydroxy)methyl]oxane-2,3,4,5-tetrol |
| InChIKey | WQZGKKKJIJFFOK-VARZTKRMSA-N |
| SMILES | [2H]C([2H])([C@@H]1[C@H]([C@@H]([C@H](C(O1)O)O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
(C~6~,C~6~-~2~H_2_)Hexopyranose, D-Glucose-6,6-d2, D-Glucose-6,6-c-d2, Glucose, 6,6-dideutero, (3R,4S,5S,6R)-6-[dideuterio(hydroxy)methyl]oxane-2,3,4,5-tetrol, D-[6,6'-2H2]glucose, D-(C~6~,C~6~-~2~H_2_)Glucopyranose, D-Glucose-6,6-d2, >=98 atom % D, >=99% (CP), D-Glucose-6,6-d2, S & P tested, >=98 atom % D, >=99% (CP), (3R,4S,5S,6R)-6-[dideuterio(hydroxy)methyl]tetrahydropyran-2,3,4,5-tetrol