CAS 19005-63-1 appears in our catalog under these names: 4-(Dimethylamino)-3-nitrobenzonitrile, 98%, 4-(dimethylamino)-3-nitrobenzonitrile, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
4-(dimethylamino)-3-nitrobenzonitrile (CAS 19005-63-1) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 4-(dimethylamino)-3-nitrobenzonitrile. InChIKey: ROVUKLFPIVOWOP-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 4-(dimethylamino)-3-nitrobenzonitrile |
| InChIKey | ROVUKLFPIVOWOP-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)