Products 1902-01-8
CAS 1902-01-8 is the registry number for rac-Calcium Pantothenate EP Impurity B Sodium Salt. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium 2,4-dihydroxy-3,3-dimethylbutanoate (CAS 1902-01-8) is a chemical compound with the molecular formula C6H11NaO4 and a molecular weight of 170.14 g/mol. IUPAC name: sodium 2,4-dihydroxy-3,3-dimethylbutanoate. InChIKey: XTIMSSMEPPKSQD-UHFFFAOYSA-M.
| Molecular formula | C6H11NaO4 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | sodium 2,4-dihydroxy-3,3-dimethylbutanoate |
| InChIKey | XTIMSSMEPPKSQD-UHFFFAOYSA-M |
| SMILES | CC(C)(CO)C(C(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)
Synonyms:
2,4-dihydroxy-3,3-dimethyl-butanoic acid, sodium;2,4-dihydroxy-3,3-dimethylbutanoate, (RS)-Pantoic Acid Sodium Salt, (RS)-Pantoic Acid Sodium Salt Monohydrate, 470-29-1(Free Acid), Butanoic acid, 2,4-dihydroxy-3,3-dimethyl-, monosodium salt, Na salt. alpha, gamma-Dihydroxy-beta, beta-dimethylbutyric acid, sodium salt