CAS 32652-17-8 appears in our catalog under these names: L-Mevalonic Acid Sodium Salt, L-Mevalonic acid lithium salt. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 25mg, 10mg, 50mg.
Sodium 3,5-dihydroxy-3-methylpentanoate (CAS 32652-17-8) is a chemical compound with the molecular formula C6H11NaO4 and a molecular weight of 170.14 g/mol. IUPAC name: sodium 3,5-dihydroxy-3-methylpentanoate. InChIKey: RIYNLCMADQUBEM-UHFFFAOYSA-M.
| Molecular formula | C6H11NaO4 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | sodium 3,5-dihydroxy-3-methylpentanoate |
| InChIKey | RIYNLCMADQUBEM-UHFFFAOYSA-M |
| SMILES | CC(CCO)(CC(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)