CAS 96949-03-0 appears in our catalog under these names: R-Mevalonic Acid Sodium Salt, >95% (HPLC), (R)-Mevalonic acid (sodium). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 25mg, 2.5 mg.
Sodium (3R)-3,5-dihydroxy-3-methylpentanoate (CAS 96949-03-0) is a chemical compound with the molecular formula C6H11NaO4 and a molecular weight of 170.14 g/mol. IUPAC name: sodium (3R)-3,5-dihydroxy-3-methylpentanoate. InChIKey: RIYNLCMADQUBEM-FYZOBXCZSA-M.
| Molecular formula | C6H11NaO4 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | sodium (3R)-3,5-dihydroxy-3-methylpentanoate |
| InChIKey | RIYNLCMADQUBEM-FYZOBXCZSA-M |
| SMILES | C[C@@](CCO)(CC(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)