CAS 1902123-70-9 is the registry number for Eltrombopag Impurity 47. Offered by: Chemat Brand. Available pack sizes: on request.
3-[3-[[1-(3,4-dimethylphenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]-2-hydroxyphenyl]benzoic acid (CAS 1902123-70-9) is a chemical compound with the molecular formula C25H22N4O4 and a molecular weight of 442.5 g/mol. IUPAC name: 3-[3-[[1-(3,4-dimethylphenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]-2-hydroxyphenyl]benzoic acid. InChIKey: XIKDKRRFSUYGHK-UHFFFAOYSA-N.
| Molecular formula | C25H22N4O4 |
|---|---|
| Molecular weight | 442.5 g/mol |
| IUPAC name | 3-[3-[[1-(3,4-dimethylphenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]-2-hydroxyphenyl]benzoic acid |
| InChIKey | XIKDKRRFSUYGHK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C(=O)C(C(=N2)C)N=NC3=CC=CC(=C3O)C4=CC(=CC=C4)C(=O)O)C |
Computed by PubChem (NCBI)