CAS 2375587-79-2 is the registry number for Fmoc-L-Phe(4-CH2-N3)-OH. Offered by: Iris Biotech, Biosynth. Available pack sizes: 1g, 5g, 50mg, 100mg, 250mg, 500mg, 2g.
(2S)-3-[4-(azidomethyl)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 2375587-79-2) is a chemical compound with the molecular formula C25H22N4O4 and a molecular weight of 442.5 g/mol. IUPAC name: (2S)-3-[4-(azidomethyl)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: RZPSIJJEHUESPS-QHCPKHFHSA-N.
| Molecular formula | C25H22N4O4 |
|---|---|
| Molecular weight | 442.5 g/mol |
| IUPAC name | (2S)-3-[4-(azidomethyl)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | RZPSIJJEHUESPS-QHCPKHFHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=C(C=C4)CN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)