Products 2375587-79-2

CAS 2375587-79-2 is the registry number for Fmoc-L-Phe(4-CH2-N3)-OH. Offered by: Iris Biotech, Biosynth. Available pack sizes: 1g, 5g, 50mg, 100mg, 250mg, 500mg, 2g.

Structural formula: {0} (CAS {1})

(2S)-3-[4-(azidomethyl)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 2375587-79-2) is a chemical compound with the molecular formula C25H22N4O4 and a molecular weight of 442.5 g/mol. IUPAC name: (2S)-3-[4-(azidomethyl)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: RZPSIJJEHUESPS-QHCPKHFHSA-N.

Identity
Molecular formulaC25H22N4O4
Molecular weight442.5 g/mol
IUPAC name(2S)-3-[4-(azidomethyl)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid
InChIKeyRZPSIJJEHUESPS-QHCPKHFHSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=C(C=C4)CN=[N+]=[N-])C(=O)O

Computed by PubChem (NCBI)

Synonyms: Fmoc-Phe(4-CH2-N3)