Products 2490154-44-2
CAS 2490154-44-2 is the registry number for Anti-MRSA agent 5. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-cyclopropyl-7-[[4-(3,4-dimethylphenoxy)pyrimidin-2-yl]amino]-4-oxoquinoline-3-carboxylic acid (CAS 2490154-44-2) is a chemical compound with the molecular formula C25H22N4O4 and a molecular weight of 442.5 g/mol. IUPAC name: 1-cyclopropyl-7-[[4-(3,4-dimethylphenoxy)pyrimidin-2-yl]amino]-4-oxoquinoline-3-carboxylic acid. InChIKey: LVWQTFGGIKODJA-UHFFFAOYSA-N.
| Molecular formula | C25H22N4O4 |
|---|---|
| Molecular weight | 442.5 g/mol |
| IUPAC name | 1-cyclopropyl-7-[[4-(3,4-dimethylphenoxy)pyrimidin-2-yl]amino]-4-oxoquinoline-3-carboxylic acid |
| InChIKey | LVWQTFGGIKODJA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC2=NC(=NC=C2)NC3=CC4=C(C=C3)C(=O)C(=CN4C5CC5)C(=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
Anti-MRSA agent 5, orb1687467