Products 19031-58-4
CAS 19031-58-4 appears in our catalog under these names: (3,4-Dimethoxyphenyl)acetic-alpha,alpha-d2 Acid, 98 atom % D, min 98% Chemical Purity, 3,4-Dimethoxyphenylacetic acid-d2. Offered by: CDN, MedChemExpress. Available pack sizes: 1g, 0,5g, 1 mg.
2,2-dideuterio-2-(3,4-dimethoxyphenyl)acetic acid (CAS 19031-58-4) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 198.21 g/mol. IUPAC name: 2,2-dideuterio-2-(3,4-dimethoxyphenyl)acetic acid. InChIKey: WUAXWQRULBZETB-NCYHJHSESA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 198.21 g/mol |
| IUPAC name | 2,2-dideuterio-2-(3,4-dimethoxyphenyl)acetic acid |
| InChIKey | WUAXWQRULBZETB-NCYHJHSESA-N |
| SMILES | [2H]C([2H])(C1=CC(=C(C=C1)OC)OC)C(=O)O |
Computed by PubChem (NCBI)