Products 190323-50-3
CAS 190323-50-3 is the registry number for ABCG2-IN-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (CAS 190323-50-3) is a chemical compound with the molecular formula C20H22O7 and a molecular weight of 374.4 g/mol. IUPAC name: (E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one. InChIKey: BEDDITQSLNWAOP-VOTSOKGWSA-N.
| Molecular formula | C20H22O7 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | (E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| InChIKey | BEDDITQSLNWAOP-VOTSOKGWSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)C(=O)/C=C/C2=CC(=C(C(=C2)OC)OC)OC)O |
Computed by PubChem (NCBI)