CAS 1903424-31-6 is the registry number for Rel-methyl (3R,4S)-3-fluoropiperidine-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (3R,4S)-3-fluoropiperidine-4-carboxylate (CAS 1903424-31-6) is a chemical compound with the molecular formula C7H12FNO2 and a molecular weight of 161.17 g/mol. IUPAC name: methyl (3R,4S)-3-fluoropiperidine-4-carboxylate. InChIKey: CITOGGQERKZEIB-RITPCOANSA-N.
| Molecular formula | C7H12FNO2 |
|---|---|
| Molecular weight | 161.17 g/mol |
| IUPAC name | methyl (3R,4S)-3-fluoropiperidine-4-carboxylate |
| InChIKey | CITOGGQERKZEIB-RITPCOANSA-N |
| SMILES | COC(=O)[C@@H]1CCNC[C@@H]1F |
Computed by PubChem (NCBI)