CAS 1903836-65-6 appears in our catalog under these names: Trans-tetrahydrofuran-3,4-dicarboxylic acid, 95%, trans–Tetrahydrofuran–3,4–dicarboxylic acid, trans-Tetrahydrofuran-3,4-dicarboxylic acid 95%, trans-Tetrahydrofuran-3,4-dicarboxylic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 50mg.
(3R,4R)-oxolane-3,4-dicarboxylic acid (CAS 1903836-65-6) is a chemical compound with the molecular formula C6H8O5 and a molecular weight of 160.12 g/mol. IUPAC name: (3R,4R)-oxolane-3,4-dicarboxylic acid. InChIKey: QUHAOMPZQHGTKN-IMJSIDKUSA-N.
| Molecular formula | C6H8O5 |
|---|---|
| Molecular weight | 160.12 g/mol |
| IUPAC name | (3R,4R)-oxolane-3,4-dicarboxylic acid |
| InChIKey | QUHAOMPZQHGTKN-IMJSIDKUSA-N |
| SMILES | C1[C@@H]([C@H](CO1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)