CAS 89886-73-7 appears in our catalog under these names: (2S,3S)-3-(Ethoxycarbonyl)-oxirane-2-carboxylic acid, 98%, (2S,3S)-2,3-Oxiranedicarboxylic Acid Monoethyl Ester, >95% (HPLC), (2S,3S)-3-(Ethoxycarbonyl)oxirane-2-carboxylic acid, 95+%, (2S, 3S)-3-(Ethoxycarbonyl)-oxirane-2-carboxylic acid. Offered by: Combi-blocks, TRC, AmBeed, Biosynth. Available pack sizes: 100mg, 250mg, 10mg, 5g, 50mg, 25mg, 500mg.
(2S,3S)-3-ethoxycarbonyloxirane-2-carboxylic acid (CAS 89886-73-7) is a chemical compound with the molecular formula C6H8O5 and a molecular weight of 160.12 g/mol. IUPAC name: (2S,3S)-3-ethoxycarbonyloxirane-2-carboxylic acid. InChIKey: MWMZDXCRDIBPCO-IMJSIDKUSA-N.
| Molecular formula | C6H8O5 |
|---|---|
| Molecular weight | 160.12 g/mol |
| IUPAC name | (2S,3S)-3-ethoxycarbonyloxirane-2-carboxylic acid |
| InChIKey | MWMZDXCRDIBPCO-IMJSIDKUSA-N |
| SMILES | CCOC(=O)[C@@H]1[C@H](O1)C(=O)O |
Computed by PubChem (NCBI)