Products 86248-59-1

CAS 86248-59-1 is the registry number for Calcium 4-carboxy-2-oxobutanoate, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.

6-hydroxy-2,5-dioxohexanoic acid (CAS 86248-59-1) is a chemical compound with the molecular formula C6H8O5 and a molecular weight of 160.12 g/mol. IUPAC name: 6-hydroxy-2,5-dioxohexanoic acid. InChIKey: MMLGKSQQXHJURG-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8O5
Molecular weight160.12 g/mol
IUPAC name6-hydroxy-2,5-dioxohexanoic acid
InChIKeyMMLGKSQQXHJURG-UHFFFAOYSA-N
SMILESC(CC(=O)C(=O)O)C(=O)CO

Computed by PubChem (NCBI)