CAS 19046-60-7 appears in our catalog under these names: alpha-D-Galactose 1-Phosphate Dipotassium Salt, >95% (HPLC), Galactose 1-phosphate Potassium salt, 98%, Galactose 1-phosphate Potassium salt/ 99.68% (existing batch purity), Galactose 1–phosphate Potassium salt, alpha-D-Galactose 1-phosphate, dipotassium salt pentahydrate. Offered by: TRC, AmBeed, TargetMol, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 50mg, 1g, 10mg, 25mg, 10mM (in 1ml water), 0,5g.
Dipotassium;[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate (CAS 19046-60-7) is a chemical compound with the molecular formula C6H11K2O9P and a molecular weight of 336.32 g/mol. IUPAC name: dipotassium;[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate. InChIKey: KCIDZIIHRGYJAE-YGFYJFDDSA-L.
| Molecular formula | C6H11K2O9P |
|---|---|
| Molecular weight | 336.32 g/mol |
| IUPAC name | dipotassium;[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
| InChIKey | KCIDZIIHRGYJAE-YGFYJFDDSA-L |
| SMILES | C([C@@H]1[C@@H]([C@@H]([C@H]([C@H](O1)OP(=O)([O-])[O-])O)O)O)O.[K+].[K+] |
Computed by PubChem (NCBI)