CAS 71888-67-0 appears in our catalog under these names: Alpha-d(+)mannose 1-phosphate dipotassium salt, 95%, a-D-Mannose-1-phosphate Dipotassium Salt, >95% (HPLC), a-D-Mannose-1-phosphate dipotassium salt, a-D-Mannose-1-phosphate dipotassium salt, min. 95 %, 50 mg, a-D-Mannose-1-phosphate dipotassium salt, min. 95 %, 100 mg. Offered by: Combi-blocks, TRC, Biosynth, Roth. Available pack sizes: 250mg, 1g, 100mg, 10mg, 50mg, 1000mg, 500mg.
Dipotassium;[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate (CAS 71888-67-0) is a chemical compound with the molecular formula C6H11K2O9P and a molecular weight of 336.32 g/mol. IUPAC name: dipotassium;[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate. InChIKey: KCIDZIIHRGYJAE-ATVZWOOISA-L.
| Molecular formula | C6H11K2O9P |
|---|---|
| Molecular weight | 336.32 g/mol |
| IUPAC name | dipotassium;[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
| InChIKey | KCIDZIIHRGYJAE-ATVZWOOISA-L |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)OP(=O)([O-])[O-])O)O)O)O.[K+].[K+] |
Computed by PubChem (NCBI)