CAS 6736-77-2 appears in our catalog under these names: Glucose-1-phosphate Dipotassium Salt, a-D-(UL-13C6)Glucose-1-phosphate dipotassium salt hydrate, α-D-Glucopyranose,1-(dihydrogen phosphate) (potassium). Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 50mg, Get quote.
Dipotassium;[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate (CAS 6736-77-2) is a chemical compound with the molecular formula C6H11K2O9P and a molecular weight of 336.32 g/mol. IUPAC name: dipotassium;[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate. InChIKey: KCIDZIIHRGYJAE-PKXGBZFFSA-L.
| Molecular formula | C6H11K2O9P |
|---|---|
| Molecular weight | 336.32 g/mol |
| IUPAC name | dipotassium;[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
| InChIKey | KCIDZIIHRGYJAE-PKXGBZFFSA-L |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)OP(=O)([O-])[O-])O)O)O)O.[K+].[K+] |
Computed by PubChem (NCBI)