Products 190516-88-2
CAS 190516-88-2 appears in our catalog under these names: 5,7-Dimethoxy-1,4-dihydroquinolin-4-one, 5,7-Dimethoxy-1,4-Dihydroquinolin-4-One, 95%, 5,7-Dimethoxyquinolin-4(1H)-one, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
5,7-dimethoxy-1H-quinolin-4-one (CAS 190516-88-2) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 5,7-dimethoxy-1H-quinolin-4-one. InChIKey: GPPGAHZMZKUMKW-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 5,7-dimethoxy-1H-quinolin-4-one |
| InChIKey | GPPGAHZMZKUMKW-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=O)C=CN2)C(=C1)OC |
Computed by PubChem (NCBI)