Products 1907649-08-4
CAS 1907649-08-4 is the registry number for 4-Bromo-1-(4-methoxybenzyl)-1H-1,2,3-triazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-bromo-1-[(4-methoxyphenyl)methyl]triazole (CAS 1907649-08-4) is a chemical compound with the molecular formula C10H10BrN3O and a molecular weight of 268.11 g/mol. IUPAC name: 4-bromo-1-[(4-methoxyphenyl)methyl]triazole. InChIKey: KUAVWEKLPZUMJH-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN3O |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | 4-bromo-1-[(4-methoxyphenyl)methyl]triazole |
| InChIKey | KUAVWEKLPZUMJH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C=C(N=N2)Br |
Computed by PubChem (NCBI)