Products 1907737-76-1
CAS 1907737-76-1 is the registry number for Sacubitril Impurity 38. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,4S)-4-acetamido-2-methyl-5-(4-phenylphenyl)pentanoic acid (CAS 1907737-76-1) is a chemical compound with the molecular formula C20H23NO3 and a molecular weight of 325.4 g/mol. IUPAC name: (2R,4S)-4-acetamido-2-methyl-5-(4-phenylphenyl)pentanoic acid. InChIKey: GITVMXNIERZYFZ-KUHUBIRLSA-N.
| Molecular formula | C20H23NO3 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (2R,4S)-4-acetamido-2-methyl-5-(4-phenylphenyl)pentanoic acid |
| InChIKey | GITVMXNIERZYFZ-KUHUBIRLSA-N |
| SMILES | C[C@H](C[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)NC(=O)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Sacubitril Valsartan Sodium Impurity 3