Products 3608-67-1

CAS 3608-67-1 is the registry number for Propiverine Hydroxy Impurity. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(1-methylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate (CAS 3608-67-1) is a chemical compound with the molecular formula C20H23NO3 and a molecular weight of 325.4 g/mol. IUPAC name: (1-methylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate. InChIKey: UGYPGJCVNPPUPE-UHFFFAOYSA-N.

Identity
Molecular formulaC20H23NO3
Molecular weight325.4 g/mol
IUPAC name(1-methylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate
InChIKeyUGYPGJCVNPPUPE-UHFFFAOYSA-N
SMILESCN1CCC(CC1)OC(=O)C(C2=CC=CC=C2)(C3=CC=CC=C3)O

Computed by PubChem (NCBI)