Products 87788-23-6
CAS 87788-23-6 is the registry number for 4-Methyl-benzoic acid 2-methyl-2-(4-methyl-benzoylamino)-propyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
[2-methyl-2-[(4-methylbenzoyl)amino]propyl] 4-methylbenzoate (CAS 87788-23-6) is a chemical compound with the molecular formula C20H23NO3 and a molecular weight of 325.4 g/mol. IUPAC name: [2-methyl-2-[(4-methylbenzoyl)amino]propyl] 4-methylbenzoate. InChIKey: XPQJTOMKWFNZTN-UHFFFAOYSA-N.
| Molecular formula | C20H23NO3 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | [2-methyl-2-[(4-methylbenzoyl)amino]propyl] 4-methylbenzoate |
| InChIKey | XPQJTOMKWFNZTN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)NC(C)(C)COC(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)