CAS 190774-58-4 appears in our catalog under these names: 2,3,4-Trifluorophenyl isocyanate, 95%, 2,3,4-Trifluorophenylisocyanate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 5g, 10g.
1,2,3-trifluoro-4-isocyanatobenzene (CAS 190774-58-4) is a chemical compound with the molecular formula C7H2F3NO and a molecular weight of 173.09 g/mol. IUPAC name: 1,2,3-trifluoro-4-isocyanatobenzene. InChIKey: LSKOUPSEWMJCEP-UHFFFAOYSA-N.
| Molecular formula | C7H2F3NO |
|---|---|
| Molecular weight | 173.09 g/mol |
| IUPAC name | 1,2,3-trifluoro-4-isocyanatobenzene |
| InChIKey | LSKOUPSEWMJCEP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N=C=O)F)F)F |
Computed by PubChem (NCBI)