CAS 932710-67-3 is the registry number for 1,2,4-Trifluoro-5-isocyanatobenzene, 97%. Offered by: AmBeed. Available pack sizes: 25g.
1,2,4-trifluoro-5-isocyanatobenzene (CAS 932710-67-3) is a chemical compound with the molecular formula C7H2F3NO and a molecular weight of 173.09 g/mol. IUPAC name: 1,2,4-trifluoro-5-isocyanatobenzene. InChIKey: FNPFGLMBBUHGAT-UHFFFAOYSA-N.
| Molecular formula | C7H2F3NO |
|---|---|
| Molecular weight | 173.09 g/mol |
| IUPAC name | 1,2,4-trifluoro-5-isocyanatobenzene |
| InChIKey | FNPFGLMBBUHGAT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)N=C=O |
Computed by PubChem (NCBI)